3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid

China cas 14346-01-1 manufacturer wholesale 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid at affordable price We provide high quality 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid (CAS 14346-01-1), at a very affordable prices to our customers.

1.What is the 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid ?

3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is an isoxazole derivative with a molecular formula of C10H5Cl2NO3S. It features a thienyl group and a carboxylic acid functional group, making it a potential inhibitor of the enzyme dihydrofolate reductase, which plays a role in DNA and RNA synthesis.
Used in Pharmaceutical Industry:
3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is used as a potential therapeutic agent for the treatment of various diseases, such as cancer and bacterial infections, due to its ability to inhibit the enzyme dihydrofolate reductase.
Used in Medicinal Chemistry Research:
3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is used as a subject of interest in the field of medicinal chemistry and drug development, given its chemical structure and properties that may contribute to the discovery of new drugs with anti-inflammatory and analgesic effects.

2.What is the CAS number for 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid ?

The CAS number of 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is 14346-01-1.

More information of 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid 14346-01-1 are:

3.What is the molecular formula of 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid ?

The chemical formula of?3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is C9H5 Cl2 N O3 S which containing 9 Carbon atoms,5 Hydrogen atoms,2 Chlorine atoms,1 Nitrogen atoms,3 Oxygen atoms and 1 Sulfur atoms,and the molecular weight, and the molecular weight of 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is 278.116

4.What is 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid(14346-01-1)used for?

3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is an isoxazole derivative with a molecular formula of C10H5Cl2NO3S. It features a thienyl group and a carboxylic acid functional group, making it a potential inhibitor of the enzyme dihydrofolate reductase, which plays a role in DNA and RNA synthesis.
Used in Pharmaceutical Industry:
3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is used as a potential therapeutic agent for the treatment of various diseases, such as cancer and bacterial infections, due to its ability to inhibit the enzyme dihydrofolate reductase.
Used in Medicinal Chemistry Research:
3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid is used as a subject of interest in the field of medicinal chemistry and drug development, given its chemical structure and properties that may contribute to the discovery of new drugs with anti-inflammatory and analgesic effects.

InChI:InChI=1/C9H5Cl2NO3S/c1-3-6(9(13)14)7(12-15-3)4-2-5(10)16-8(4)11/h2H,1H3,(H,13,14)

Relevant articles related to 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid:

5.China cas 14346-01-1 manufacturer wholesale 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid at affordable price

qingdao chuangnuo medical technology co., ltd is a quality supplier of 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 3-(2,5-dichloro-3-thienyl)-5-methylisoxazole-4-carboxylic acid 14346-01-1.